C26H32N4O2S — CID 69154190
N-[2-[[2-(4-phenylpiperazin-1-yl)propylamino]methyl]phenyl]benzenesulfonamide (PubChem CID 69154190) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is N-[2-[[2-(4-phenylpiperazin-1-yl)propylamino]methyl]phenyl]benzenesulfonamide.
| Compound Name | N-[2-[[2-(4-phenylpiperazin-1-yl)propylamino]methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69154190 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | N-[2-[[2-(4-phenylpiperazin-1-yl)propylamino]methyl]phenyl]benzenesulfonamide |
| SMILES | CC(CNCc1ccccc1NS(=O)(=O)c1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N4O2S/c1-22(29-16-18-30(19-17-29)24-11-4-2-5-12-24)20-27-21-23-10-8-9-15-26(23)28-33(31,32)25-13-6-3-7-14-25/h2-15,22,27-28H,16-21H2,1H3 |
| InChIKey | FMYHMDMIGXGDFA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |