C12H16OS — CID 69154313
1,4a,5,6a,7,10,10a,10b-octahydrothiopyrano[2,3-c]chromene (PubChem CID 69154313) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is 1,4a,5,6a,7,10,10a,10b-octahydrothiopyrano[2,3-c]chromene.
| Compound Name | 1,4a,5,6a,7,10,10a,10b-octahydrothiopyrano[2,3-c]chromene |
|---|---|
| PubChem CID | 69154313 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1,4a,5,6a,7,10,10a,10b-octahydrothiopyrano[2,3-c]chromene |
| SMILES | C1=CCC2C(C1)OCC1SC=CCC12 |
| InChI | InChI=1S/C12H16OS/c1-2-6-11-9(4-1)10-5-3-7-14-12(10)8-13-11/h1-3,7,9-12H,4-6,8H2 |
| InChIKey | HXNYJWGGIZBEMJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|