C25H24N4O3 — CID 69154485
7-cyclohexyl-3-nitro-2-(4-phenylmethoxyphenyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 69154485) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 7-cyclohexyl-3-nitro-2-(4-phenylmethoxyphenyl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-cyclohexyl-3-nitro-2-(4-phenylmethoxyphenyl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 69154485 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 7-cyclohexyl-3-nitro-2-(4-phenylmethoxyphenyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | O=[N+]([O-])c1c(-c2ccc(OCc3ccccc3)cc2)nn2c(C3CCCCC3)ccnc12 |
| InChI | InChI=1S/C25H24N4O3/c30-29(31)24-23(20-11-13-21(14-12-20)32-17-18-7-3-1-4-8-18)27-28-22(15-16-26-25(24)28)19-9-5-2-6-10-19/h1,3-4,7-8,11-16,19H,2,5-6,9-10,17H2 |
| InChIKey | VWNYKGYLLOHVKW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|