About 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one
5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one (PubChem CID 69154568) has the molecular formula C20H17F2N3O2
and a molecular weight of 369.37 g/mol. Its IUPAC name is 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one.
Molecular Properties
| Compound Name | 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one |
| PubChem CID | 69154568 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one |
| SMILES | CCn1nc(-c2ccccc2)c(C(C)=O)c(Nc2c(F)cccc2F)c1=O |
| InChI | InChI=1S/C20H17F2N3O2/c1-3-25-20(27)19(23-18-14(21)10-7-11-15(18)22)16(12(2)26)17(24-25)13-8-5-4-6-9-13/h4-11,23H,3H2,1-2H3 |
| InChIKey | KMXAKLYKSWWOBU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one?
The IUPAC name of 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one (CID 69154568) is 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one.
What is the SMILES notation for 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one?
The canonical SMILES for 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one is CCn1nc(-c2ccccc2)c(C(C)=O)c(Nc2c(F)cccc2F)c1=O.
What is the InChIKey of 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one?
The InChIKey is KMXAKLYKSWWOBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2N3O2/c1-3-25-20(27)19(23-18-14(21)10-7-11-15(18)22)16(12(2)26)17(24-25)13-8-5-4-6-9-13/h4-11,23H,3H2,1-2H3.
What are the key properties of 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one?
5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one has a molecular weight of 369.37 g/mol, XLogP of 4.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-4-(2,6-difluoroanilino)-2-ethyl-6-phenylpyridazin-3-one is sourced from PubChem (CID 69154568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).