About 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide
2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide (PubChem CID 69154947) has the molecular formula C13H8Br3NO2S
and a molecular weight of 481.99 g/mol. Its IUPAC name is 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide.
Molecular Properties
| Compound Name | 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide |
| PubChem CID | 69154947 |
| Molecular Formula | C13H8Br3NO2S |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 478.78 |
| IUPAC Name | 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide |
| SMILES | CN1c2ccc(Br)cc2S(=O)(=O)c2cc(Br)c(Br)cc21 |
| InChI | InChI=1S/C13H8Br3NO2S/c1-17-10-3-2-7(14)4-12(10)20(18,19)13-6-9(16)8(15)5-11(13)17/h2-6H,1H3 |
| InChIKey | HZYFPECGVCCXBY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide?
The IUPAC name of 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide (CID 69154947) is 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide.
What is the SMILES notation for 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide?
The canonical SMILES for 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide is CN1c2ccc(Br)cc2S(=O)(=O)c2cc(Br)c(Br)cc21.
What is the InChIKey of 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide?
The InChIKey is HZYFPECGVCCXBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Br3NO2S/c1-17-10-3-2-7(14)4-12(10)20(18,19)13-6-9(16)8(15)5-11(13)17/h2-6H,1H3.
What are the key properties of 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide?
2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide has a molecular weight of 481.99 g/mol, XLogP of 4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,7-tribromo-10-methylphenothiazine 5,5-dioxide is sourced from PubChem (CID 69154947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).