C21H21F3N2O2S — CID 69154956
[2,6-dipropyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl] acetate (PubChem CID 69154956) has the molecular formula C21H21F3N2O2S and a molecular weight of 422.47 g/mol. Its IUPAC name is [2,6-dipropyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl] acetate.
| Compound Name | [2,6-dipropyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl] acetate |
|---|---|
| PubChem CID | 69154956 |
| Molecular Formula | C21H21F3N2O2S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [2,6-dipropyl-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-3-pyridinyl] acetate |
| SMILES | CCCc1nc(CCC)c(OC(C)=O)cc1Cc1nc2c(F)c(F)cc(F)c2s1 |
| InChI | InChI=1S/C21H21F3N2O2S/c1-4-6-15-12(8-17(28-11(3)27)16(25-15)7-5-2)9-18-26-20-19(24)13(22)10-14(23)21(20)29-18/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | GZWNCNKBHGXWEU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|