C27H26N6O5 — CID 69155101
(3R)-3-(4,8-dimethoxyquinoline-2-carbonyl)-6-(2-methyltetrazol-5-yl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 69155101) has the molecular formula C27H26N6O5 and a molecular weight of 514.54 g/mol. Its IUPAC name is (3R)-3-(4,8-dimethoxyquinoline-2-carbonyl)-6-(2-methyltetrazol-5-yl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | (3R)-3-(4,8-dimethoxyquinoline-2-carbonyl)-6-(2-methyltetrazol-5-yl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 69155101 |
| Molecular Formula | C27H26N6O5 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | (3R)-3-(4,8-dimethoxyquinoline-2-carbonyl)-6-(2-methyltetrazol-5-yl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1cc(C(=O)[C@H]2C(=O)c3cc(-c4nnn(C)n4)ccc3OC23CCNCC3)nc2c(OC)cccc12 |
| InChI | InChI=1S/C27H26N6O5/c1-33-31-26(30-32-33)15-7-8-19-17(13-15)24(34)22(27(38-19)9-11-28-12-10-27)25(35)18-14-21(37-3)16-5-4-6-20(36-2)23(16)29-18/h4-8,13-14,22,28H,9-12H2,1-3H3/t22-/m1/s1 |
| InChIKey | NMUKZWBKGLDLPA-JOCHJYFZSA-N |
| XLogP | 2.64 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|