About [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride
[4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride (PubChem CID 69156383) has the molecular formula C9H12ClN5
and a molecular weight of 225.68 g/mol. Its IUPAC name is [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride.
Molecular Properties
| Compound Name | [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride |
| PubChem CID | 69156383 |
| Molecular Formula | C9H12ClN5 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride |
| SMILES | Cl.NNc1ccc(Cc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C9H11N5.ClH/c10-13-8-3-1-7(2-4-8)5-9-11-6-12-14-9;/h1-4,6,13H,5,10H2,(H,11,12,14);1H |
| InChIKey | IBHLYHJTOYYXPE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride?
The IUPAC name of [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride (CID 69156383) is [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride.
What is the SMILES notation for [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride?
The canonical SMILES for [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride is Cl.NNc1ccc(Cc2ncn[nH]2)cc1.
What is the InChIKey of [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride?
The InChIKey is IBHLYHJTOYYXPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5.ClH/c10-13-8-3-1-7(2-4-8)5-9-11-6-12-14-9;/h1-4,6,13H,5,10H2,(H,11,12,14);1H.
What are the key properties of [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride?
[4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride has a molecular weight of 225.68 g/mol, XLogP of 1.10, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1H-1,2,4-triazol-5-ylmethyl)phenyl]hydrazine;hydrochloride is sourced from PubChem (CID 69156383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).