About 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol
4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol (PubChem CID 69156701) has the molecular formula C25H19F3N4O
and a molecular weight of 448.45 g/mol. Its IUPAC name is 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol.
Molecular Properties
| Compound Name | 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol |
| PubChem CID | 69156701 |
| Molecular Formula | C25H19F3N4O |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol |
| SMILES | NCCc1ccc(-n2cnc3cnc4ccc(-c5ccc(O)cc5)cc4c32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H19F3N4O/c26-25(27,28)20-11-15(9-10-29)1-8-23(20)32-14-31-22-13-30-21-7-4-17(12-19(21)24(22)32)16-2-5-18(33)6-3-16/h1-8,11-14,33H,9-10,29H2 |
| InChIKey | SPZVNAUJMLWNLX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol?
The IUPAC name of 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol (CID 69156701) is 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol.
What is the SMILES notation for 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol?
The canonical SMILES for 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol is NCCc1ccc(-n2cnc3cnc4ccc(-c5ccc(O)cc5)cc4c32)c(C(F)(F)F)c1.
What is the InChIKey of 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol?
The InChIKey is SPZVNAUJMLWNLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19F3N4O/c26-25(27,28)20-11-15(9-10-29)1-8-23(20)32-14-31-22-13-30-21-7-4-17(12-19(21)24(22)32)16-2-5-18(33)6-3-16/h1-8,11-14,33H,9-10,29H2.
What are the key properties of 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol?
4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol has a molecular weight of 448.45 g/mol, XLogP of 5.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[4-(2-aminoethyl)-2-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-8-yl]phenol is sourced from PubChem (CID 69156701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).