About 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide
9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide (PubChem CID 69156848) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide.
Molecular Properties
| Compound Name | 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide |
| PubChem CID | 69156848 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide |
| SMILES | NC(=O)C1C=CC2=CN=c3ccccc3=CN21 |
| InChI | InChI=1S/C13H11N3O/c14-13(17)12-6-5-10-7-15-11-4-2-1-3-9(11)8-16(10)12/h1-8,12H,(H2,14,17) |
| InChIKey | ISSULNMPIHEAQW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide?
The IUPAC name of 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide (CID 69156848) is 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide.
What is the SMILES notation for 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide?
The canonical SMILES for 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide is NC(=O)C1C=CC2=CN=c3ccccc3=CN21.
What is the InChIKey of 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide?
The InChIKey is ISSULNMPIHEAQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c14-13(17)12-6-5-10-7-15-11-4-2-1-3-9(11)8-16(10)12/h1-8,12H,(H2,14,17).
What are the key properties of 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide?
9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide has a molecular weight of 225.25 g/mol, XLogP of -0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-pyrrolo[2,1-c][1,4]benzodiazepine-9-carboxamide is sourced from PubChem (CID 69156848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).