C20H15F6N5OS2 — CID 6915709
N-[5-[1-[3,5-bis(trifluoromethyl)phenyl]ethylcarbamothioylamino]-2-pyridinyl]-1,3-thiazole-4-carboxamide (PubChem CID 6915709) has the molecular formula C20H15F6N5OS2 and a molecular weight of 519.50 g/mol. Its IUPAC name is N-[5-[1-[3,5-bis(trifluoromethyl)phenyl]ethylcarbamothioylamino]-2-pyridinyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-[1-[3,5-bis(trifluoromethyl)phenyl]ethylcarbamothioylamino]-2-pyridinyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 6915709 |
| Molecular Formula | C20H15F6N5OS2 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | N-[5-[1-[3,5-bis(trifluoromethyl)phenyl]ethylcarbamothioylamino]-2-pyridinyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(NC(=S)Nc1ccc(NC(=O)c2cscn2)nc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H15F6N5OS2/c1-10(11-4-12(19(21,22)23)6-13(5-11)20(24,25)26)29-18(33)30-14-2-3-16(27-7-14)31-17(32)15-8-34-9-28-15/h2-10H,1H3,(H,27,31,32)(H2,29,30,33) |
| InChIKey | YYLROCOWYKXSDJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|