C24H18FNO3 — CID 69157223
methyl 2-benzyl-6-fluoro-1-oxo-4-phenylisoquinoline-3-carboxylate (PubChem CID 69157223) has the molecular formula C24H18FNO3 and a molecular weight of 387.41 g/mol. Its IUPAC name is methyl 2-benzyl-6-fluoro-1-oxo-4-phenylisoquinoline-3-carboxylate.
| Compound Name | methyl 2-benzyl-6-fluoro-1-oxo-4-phenylisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 69157223 |
| Molecular Formula | C24H18FNO3 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl 2-benzyl-6-fluoro-1-oxo-4-phenylisoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)c2cc(F)ccc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H18FNO3/c1-29-24(28)22-21(17-10-6-3-7-11-17)20-14-18(25)12-13-19(20)23(27)26(22)15-16-8-4-2-5-9-16/h2-14H,15H2,1H3 |
| InChIKey | JSUMYPGXAUZERN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |