About 3,7-dibenzyl-8,9-dihydropurin-2-one
3,7-dibenzyl-8,9-dihydropurin-2-one (PubChem CID 69157659) has the molecular formula C19H18N4O
and a molecular weight of 318.38 g/mol. Its IUPAC name is 3,7-dibenzyl-8,9-dihydropurin-2-one.
Molecular Properties
| Compound Name | 3,7-dibenzyl-8,9-dihydropurin-2-one |
| PubChem CID | 69157659 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3,7-dibenzyl-8,9-dihydropurin-2-one |
| SMILES | O=c1ncc2c(n1Cc1ccccc1)NCN2Cc1ccccc1 |
| InChI | InChI=1S/C19H18N4O/c24-19-20-11-17-18(23(19)13-16-9-5-2-6-10-16)21-14-22(17)12-15-7-3-1-4-8-15/h1-11,21H,12-14H2 |
| InChIKey | ROCKMIXOVQBJKK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,7-dibenzyl-8,9-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dibenzyl-8,9-dihydropurin-2-one?
The IUPAC name of 3,7-dibenzyl-8,9-dihydropurin-2-one (CID 69157659) is 3,7-dibenzyl-8,9-dihydropurin-2-one.
What is the SMILES notation for 3,7-dibenzyl-8,9-dihydropurin-2-one?
The canonical SMILES for 3,7-dibenzyl-8,9-dihydropurin-2-one is O=c1ncc2c(n1Cc1ccccc1)NCN2Cc1ccccc1.
What is the InChIKey of 3,7-dibenzyl-8,9-dihydropurin-2-one?
The InChIKey is ROCKMIXOVQBJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O/c24-19-20-11-17-18(23(19)13-16-9-5-2-6-10-16)21-14-22(17)12-15-7-3-1-4-8-15/h1-11,21H,12-14H2.
What are the key properties of 3,7-dibenzyl-8,9-dihydropurin-2-one?
3,7-dibenzyl-8,9-dihydropurin-2-one has a molecular weight of 318.38 g/mol, XLogP of 2.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dibenzyl-8,9-dihydropurin-2-one is sourced from PubChem (CID 69157659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).