About thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate
thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate (PubChem CID 69157838) has the molecular formula C19H16N2O2S
and a molecular weight of 336.42 g/mol. Its IUPAC name is thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate.
Molecular Properties
| Compound Name | thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate |
| PubChem CID | 69157838 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate |
| SMILES | Cc1cccc(C=Cc2cccc(NC(=O)Oc3cccs3)c2)n1 |
| InChI | InChI=1S/C19H16N2O2S/c1-14-5-2-7-16(20-14)11-10-15-6-3-8-17(13-15)21-19(22)23-18-9-4-12-24-18/h2-13H,1H3,(H,21,22) |
| InChIKey | BHXUDKFZIYDRNG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate?
The IUPAC name of thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate (CID 69157838) is thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate.
What is the SMILES notation for thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate?
The canonical SMILES for thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate is Cc1cccc(C=Cc2cccc(NC(=O)Oc3cccs3)c2)n1.
What is the InChIKey of thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate?
The InChIKey is BHXUDKFZIYDRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O2S/c1-14-5-2-7-16(20-14)11-10-15-6-3-8-17(13-15)21-19(22)23-18-9-4-12-24-18/h2-13H,1H3,(H,21,22).
What are the key properties of thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate?
thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate has a molecular weight of 336.42 g/mol, XLogP of 5.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-yl N-[3-[2-(6-methyl-2-pyridinyl)ethenyl]phenyl]carbamate is sourced from PubChem (CID 69157838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).