C24H35Cl2N3O5S — CID 69158501
7-[2,2-dihydroxy-2-[2-[3-[(3-propan-2-yloxypropylamino)methyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;dihydrochloride (PubChem CID 69158501) has the molecular formula C24H35Cl2N3O5S and a molecular weight of 548.53 g/mol. Its IUPAC name is 7-[2,2-dihydroxy-2-[2-[3-[(3-propan-2-yloxypropylamino)methyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;dihydrochloride.
| Compound Name | 7-[2,2-dihydroxy-2-[2-[3-[(3-propan-2-yloxypropylamino)methyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;dihydrochloride |
|---|---|
| PubChem CID | 69158501 |
| Molecular Formula | C24H35Cl2N3O5S |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 7-[2,2-dihydroxy-2-[2-[3-[(3-propan-2-yloxypropylamino)methyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;dihydrochloride |
| SMILES | CC(C)OCCCNCc1cccc(CCNC(O)(O)Cc2ccc(O)c3[nH]c(=O)sc23)c1.Cl.Cl |
| InChI | InChI=1S/C24H33N3O5S.2ClH/c1-16(2)32-12-4-10-25-15-18-6-3-5-17(13-18)9-11-26-24(30,31)14-19-7-8-20(28)21-22(19)33-23(29)27-21;;/h3,5-8,13,16,25-26,28,30-31H,4,9-12,14-15H2,1-2H3,(H,27,29);2*1H |
| InChIKey | GRYJAPLHRJYRSL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|