About N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine
N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine (PubChem CID 69158854) has the molecular formula C17H11F3N6
and a molecular weight of 356.31 g/mol. Its IUPAC name is N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine.
Molecular Properties
| Compound Name | N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine |
| PubChem CID | 69158854 |
| Molecular Formula | C17H11F3N6 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine |
| SMILES | FC(F)(F)c1ccc(-c2cnnc(Nc3cccn4nncc34)c2)cc1 |
| InChI | InChI=1S/C17H11F3N6/c18-17(19,20)13-5-3-11(4-6-13)12-8-16(24-21-9-12)23-14-2-1-7-26-15(14)10-22-25-26/h1-10H,(H,23,24) |
| InChIKey | NLGWHDZUHNNFHR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine?
The IUPAC name of N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine (CID 69158854) is N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine.
What is the SMILES notation for N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine?
The canonical SMILES for N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine is FC(F)(F)c1ccc(-c2cnnc(Nc3cccn4nncc34)c2)cc1.
What is the InChIKey of N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine?
The InChIKey is NLGWHDZUHNNFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F3N6/c18-17(19,20)13-5-3-11(4-6-13)12-8-16(24-21-9-12)23-14-2-1-7-26-15(14)10-22-25-26/h1-10H,(H,23,24).
What are the key properties of N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine?
N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine has a molecular weight of 356.31 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[4-(trifluoromethyl)phenyl]pyridazin-3-yl]triazolo[1,5-a]pyridin-4-amine is sourced from PubChem (CID 69158854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).