C22H27NO2 — CID 69158922
(2S,3S)-3-phenyl-3-spiro[2H-indole-3,1'-cyclohexane]-1-ylpropane-1,2-diol (PubChem CID 69158922) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (2S,3S)-3-phenyl-3-spiro[2H-indole-3,1'-cyclohexane]-1-ylpropane-1,2-diol.
| Compound Name | (2S,3S)-3-phenyl-3-spiro[2H-indole-3,1'-cyclohexane]-1-ylpropane-1,2-diol |
|---|---|
| PubChem CID | 69158922 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (2S,3S)-3-phenyl-3-spiro[2H-indole-3,1'-cyclohexane]-1-ylpropane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H](c1ccccc1)N1CC2(CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C22H27NO2/c24-15-20(25)21(17-9-3-1-4-10-17)23-16-22(13-7-2-8-14-22)18-11-5-6-12-19(18)23/h1,3-6,9-12,20-21,24-25H,2,7-8,13-16H2/t20-,21+/m1/s1 |
| InChIKey | LXMMFSXCFOFXSO-RTWAWAEBSA-N |
| XLogP | 3.80 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |