C25H33N3O4S — CID 69158963
7-[2-[2-[3-[2-(cyclohexylamino)ethyl]phenyl]ethylamino]-1,1-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 69158963) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is 7-[2-[2-[3-[2-(cyclohexylamino)ethyl]phenyl]ethylamino]-1,1-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one.
| Compound Name | 7-[2-[2-[3-[2-(cyclohexylamino)ethyl]phenyl]ethylamino]-1,1-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 69158963 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 7-[2-[2-[3-[2-(cyclohexylamino)ethyl]phenyl]ethylamino]-1,1-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(O)ccc(C(O)(O)CNCCc3cccc(CCNC4CCCCC4)c3)c2s1 |
| InChI | InChI=1S/C25H33N3O4S/c29-21-10-9-20(23-22(21)28-24(30)33-23)25(31,32)16-26-13-11-17-5-4-6-18(15-17)12-14-27-19-7-2-1-3-8-19/h4-6,9-10,15,19,26-27,29,31-32H,1-3,7-8,11-14,16H2,(H,28,30) |
| InChIKey | ODMBGHLIOAQBEW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|