About cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride
cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride (PubChem CID 69159090) has the molecular formula C19H32ClF3N4O2
and a molecular weight of 440.94 g/mol. Its IUPAC name is cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride |
| PubChem CID | 69159090 |
| Molecular Formula | C19H32ClF3N4O2 |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cnn(C2CCCCC2)c1C(F)(F)F.Cl.NNC1CCCCC1 |
| InChI | InChI=1S/C13H17F3N2O2.C6H14N2.ClH/c1-2-20-12(19)10-8-17-18(11(10)13(14,15)16)9-6-4-3-5-7-9;7-8-6-4-2-1-3-5-6;/h8-9H,2-7H2,1H3;6,8H,1-5,7H2;1H |
| InChIKey | CQXNZDPIRVVHCR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride?
The IUPAC name of cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride (CID 69159090) is cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride.
What is the SMILES notation for cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride?
The canonical SMILES for cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride is CCOC(=O)c1cnn(C2CCCCC2)c1C(F)(F)F.Cl.NNC1CCCCC1.
What is the InChIKey of cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride?
The InChIKey is CQXNZDPIRVVHCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N2O2.C6H14N2.ClH/c1-2-20-12(19)10-8-17-18(11(10)13(14,15)16)9-6-4-3-5-7-9;7-8-6-4-2-1-3-5-6;/h8-9H,2-7H2,1H3;6,8H,1-5,7H2;1H.
What are the key properties of cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride?
cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride has a molecular weight of 440.94 g/mol, XLogP of 4.79, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylhydrazine;ethyl 1-cyclohexyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride is sourced from PubChem (CID 69159090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).