N,N-diethylcarbamoyl chloride

C5H10ClNO — CID 6916

IUPACN,N-diethylcarbamoyl chloride
SMILESCCN(CC)C(=O)Cl
InChIInChI=1S/C5H10ClNO/c1-3-7(4-2)5(6)8/h3-4H2,1-2H3
InChIKeyOFCCYDUUBNUJIB-UHFFFAOYSA-N
MW135.59 g/mol
LogP1.69
Rot. Bonds2

About N,N-diethylcarbamoyl chloride

N,N-diethylcarbamoyl chloride (PubChem CID 6916) has the molecular formula C5H10ClNO and a molecular weight of 135.59 g/mol. Its IUPAC name is N,N-diethylcarbamoyl chloride.

Molecular Properties

Compound NameN,N-diethylcarbamoyl chloride
PubChem CID6916
Molecular FormulaC5H10ClNO
Molecular Weight135.59 g/mol
Exact Mass135.05
IUPAC NameN,N-diethylcarbamoyl chloride
SMILESCCN(CC)C(=O)Cl
InChIInChI=1S/C5H10ClNO/c1-3-7(4-2)5(6)8/h3-4H2,1-2H3
InChIKeyOFCCYDUUBNUJIB-UHFFFAOYSA-N
XLogP1.69
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.59
LogP ≤ 51.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N,N-diethylcarbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diethylcarbamoyl chloride?
The IUPAC name of N,N-diethylcarbamoyl chloride (CID 6916) is N,N-diethylcarbamoyl chloride.
What is the SMILES notation for N,N-diethylcarbamoyl chloride?
The canonical SMILES for N,N-diethylcarbamoyl chloride is CCN(CC)C(=O)Cl.
What is the InChIKey of N,N-diethylcarbamoyl chloride?
The InChIKey is OFCCYDUUBNUJIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10ClNO/c1-3-7(4-2)5(6)8/h3-4H2,1-2H3.
What are the key properties of N,N-diethylcarbamoyl chloride?
N,N-diethylcarbamoyl chloride has a molecular weight of 135.59 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylcarbamoyl chloride is sourced from PubChem (CID 6916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).