C25H29N7O2 — CID 69160107
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[2-[2-(pyrrolidin-2-ylmethylamino)pyrimidin-5-yl]ethynyl]phenyl]urea (PubChem CID 69160107) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[2-[2-(pyrrolidin-2-ylmethylamino)pyrimidin-5-yl]ethynyl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[2-[2-(pyrrolidin-2-ylmethylamino)pyrimidin-5-yl]ethynyl]phenyl]urea |
|---|---|
| PubChem CID | 69160107 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[3-[2-[2-(pyrrolidin-2-ylmethylamino)pyrimidin-5-yl]ethynyl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2cccc(C#Cc3cnc(NCC4CCCN4)nc3)c2)no1 |
| InChI | InChI=1S/C25H29N7O2/c1-25(2,3)21-13-22(32-34-21)31-24(33)30-19-7-4-6-17(12-19)9-10-18-14-27-23(28-15-18)29-16-20-8-5-11-26-20/h4,6-7,12-15,20,26H,5,8,11,16H2,1-3H3,(H,27,28,29)(H2,30,31,32,33) |
| InChIKey | DOLPBJVZGHDHCY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|