About N-ethyl-N-propyl-1,3,5-triazin-2-amine
N-ethyl-N-propyl-1,3,5-triazin-2-amine (PubChem CID 69160465) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is N-ethyl-N-propyl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | N-ethyl-N-propyl-1,3,5-triazin-2-amine |
| PubChem CID | 69160465 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N-ethyl-N-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCN(CC)c1ncncn1 |
| InChI | InChI=1S/C8H14N4/c1-3-5-12(4-2)8-10-6-9-7-11-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | RRFBVTSZCZSHSX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-propyl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propyl-1,3,5-triazin-2-amine?
The IUPAC name of N-ethyl-N-propyl-1,3,5-triazin-2-amine (CID 69160465) is N-ethyl-N-propyl-1,3,5-triazin-2-amine.
What is the SMILES notation for N-ethyl-N-propyl-1,3,5-triazin-2-amine?
The canonical SMILES for N-ethyl-N-propyl-1,3,5-triazin-2-amine is CCCN(CC)c1ncncn1.
What is the InChIKey of N-ethyl-N-propyl-1,3,5-triazin-2-amine?
The InChIKey is RRFBVTSZCZSHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-3-5-12(4-2)8-10-6-9-7-11-8/h6-7H,3-5H2,1-2H3.
What are the key properties of N-ethyl-N-propyl-1,3,5-triazin-2-amine?
N-ethyl-N-propyl-1,3,5-triazin-2-amine has a molecular weight of 166.23 g/mol, XLogP of 1.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propyl-1,3,5-triazin-2-amine is sourced from PubChem (CID 69160465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).