About cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride
cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride (PubChem CID 69160577) has the molecular formula C17H28ClF3N4O2
and a molecular weight of 412.88 g/mol. Its IUPAC name is cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride |
| PubChem CID | 69160577 |
| Molecular Formula | C17H28ClF3N4O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cnn(C2CCCC2)c1C(F)(F)F.Cl.NNC1CCCC1 |
| InChI | InChI=1S/C12H15F3N2O2.C5H12N2.ClH/c1-2-19-11(18)9-7-16-17(8-5-3-4-6-8)10(9)12(13,14)15;6-7-5-3-1-2-4-5;/h7-8H,2-6H2,1H3;5,7H,1-4,6H2;1H |
| InChIKey | HSZQDYMGOHYZLS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride?
The IUPAC name of cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride (CID 69160577) is cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride.
What is the SMILES notation for cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride?
The canonical SMILES for cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride is CCOC(=O)c1cnn(C2CCCC2)c1C(F)(F)F.Cl.NNC1CCCC1.
What is the InChIKey of cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride?
The InChIKey is HSZQDYMGOHYZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O2.C5H12N2.ClH/c1-2-19-11(18)9-7-16-17(8-5-3-4-6-8)10(9)12(13,14)15;6-7-5-3-1-2-4-5;/h7-8H,2-6H2,1H3;5,7H,1-4,6H2;1H.
What are the key properties of cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride?
cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride has a molecular weight of 412.88 g/mol, XLogP of 4.01, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylhydrazine;ethyl 1-cyclopentyl-5-(trifluoromethyl)pyrazole-4-carboxylate;hydrochloride is sourced from PubChem (CID 69160577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).