About N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide
N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide (PubChem CID 69161392) has the molecular formula C7H7F3N2O
and a molecular weight of 192.14 g/mol. Its IUPAC name is N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide |
| PubChem CID | 69161392 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide |
| SMILES | O=C(NC(F)(F)F)C1=CC=CNC1 |
| InChI | InChI=1S/C7H7F3N2O/c8-7(9,10)12-6(13)5-2-1-3-11-4-5/h1-3,11H,4H2,(H,12,13) |
| InChIKey | QAVMIMJDBKJLEC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide?
The IUPAC name of N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide (CID 69161392) is N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide.
What is the SMILES notation for N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide?
The canonical SMILES for N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide is O=C(NC(F)(F)F)C1=CC=CNC1.
What is the InChIKey of N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide?
The InChIKey is QAVMIMJDBKJLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O/c8-7(9,10)12-6(13)5-2-1-3-11-4-5/h1-3,11H,4H2,(H,12,13).
What are the key properties of N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide?
N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide has a molecular weight of 192.14 g/mol, XLogP of 0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide is sourced from PubChem (CID 69161392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).