About benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide
benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide (PubChem CID 69163416) has the molecular formula C25H28N4O4
and a molecular weight of 448.52 g/mol. Its IUPAC name is benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide.
Molecular Properties
| Compound Name | benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide |
| PubChem CID | 69163416 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide |
| SMILES | COc1cc(Nc2cccc(C(N)=O)c2NCCO)cc(C)c1OC.N#Cc1ccccc1 |
| InChI | InChI=1S/C18H23N3O4.C7H5N/c1-11-9-12(10-15(24-2)17(11)25-3)21-14-6-4-5-13(18(19)23)16(14)20-7-8-22;8-6-7-4-2-1-3-5-7/h4-6,9-10,20-22H,7-8H2,1-3H3,(H2,19,23);1-5H |
| InChIKey | FNUSBTIUCINFQC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide?
The IUPAC name of benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide (CID 69163416) is benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide.
What is the SMILES notation for benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide?
The canonical SMILES for benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide is COc1cc(Nc2cccc(C(N)=O)c2NCCO)cc(C)c1OC.N#Cc1ccccc1.
What is the InChIKey of benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide?
The InChIKey is FNUSBTIUCINFQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O4.C7H5N/c1-11-9-12(10-15(24-2)17(11)25-3)21-14-6-4-5-13(18(19)23)16(14)20-7-8-22;8-6-7-4-2-1-3-5-7/h4-6,9-10,20-22H,7-8H2,1-3H3,(H2,19,23);1-5H.
What are the key properties of benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide?
benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide has a molecular weight of 448.52 g/mol, XLogP of 3.82, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;3-(3,4-dimethoxy-5-methylanilino)-2-(2-hydroxyethylamino)benzamide is sourced from PubChem (CID 69163416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).