About 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole
1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole (PubChem CID 69163553) has the molecular formula C14H12N2S2
and a molecular weight of 272.40 g/mol. Its IUPAC name is 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole |
| PubChem CID | 69163553 |
| Molecular Formula | C14H12N2S2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole |
| SMILES | c1ccc2c(c1)NCS2.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H7NS.C7H5NS/c2*1-2-4-7-6(3-1)8-5-9-7/h1-4,8H,5H2;1-5H |
| InChIKey | HEKVKVBSMZGEQO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole?
The IUPAC name of 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole (CID 69163553) is 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole.
What is the SMILES notation for 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole?
The canonical SMILES for 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole is c1ccc2c(c1)NCS2.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole?
The InChIKey is HEKVKVBSMZGEQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS.C7H5NS/c2*1-2-4-7-6(3-1)8-5-9-7/h1-4,8H,5H2;1-5H.
What are the key properties of 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole?
1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole has a molecular weight of 272.40 g/mol, XLogP of 4.46, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;2,3-dihydro-1,3-benzothiazole is sourced from PubChem (CID 69163553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).