C19H20N4O4S — CID 69163746
1-methyl-3-[(sulfamoylamino)methyl]benzene;2-phenylpyrimidine-5-carboxylic acid (PubChem CID 69163746) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 1-methyl-3-[(sulfamoylamino)methyl]benzene;2-phenylpyrimidine-5-carboxylic acid.
| Compound Name | 1-methyl-3-[(sulfamoylamino)methyl]benzene;2-phenylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 69163746 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-methyl-3-[(sulfamoylamino)methyl]benzene;2-phenylpyrimidine-5-carboxylic acid |
| SMILES | Cc1cccc(CNS(N)(=O)=O)c1.O=C(O)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C11H8N2O2.C8H12N2O2S/c14-11(15)9-6-12-10(13-7-9)8-4-2-1-3-5-8;1-7-3-2-4-8(5-7)6-10-13(9,11)12/h1-7H,(H,14,15);2-5,10H,6H2,1H3,(H2,9,11,12) |
| InChIKey | SQLWLROPTMMGSK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |