About 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate)
2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate) (PubChem CID 69164105) has the molecular formula C18H26O13
and a molecular weight of 450.39 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate).
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate) |
| PubChem CID | 69164105 |
| Molecular Formula | C18H26O13 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate) |
| SMILES | C=C(C)C(=O)OC1COC(=O)O1.C=C(C)C(=O)OC1COC(=O)O1.OCCOCCO |
| InChI | InChI=1S/2C7H8O5.C4H10O3/c2*1-4(2)6(8)11-5-3-10-7(9)12-5;5-1-3-7-4-2-6/h2*5H,1,3H2,2H3;5-6H,1-4H2 |
| InChIKey | RVYNYTJXPZTGTB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate)?
The IUPAC name of 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate) (CID 69164105) is 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate).
What is the SMILES notation for 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate)?
The canonical SMILES for 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate) is C=C(C)C(=O)OC1COC(=O)O1.C=C(C)C(=O)OC1COC(=O)O1.OCCOCCO.
What is the InChIKey of 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate)?
The InChIKey is RVYNYTJXPZTGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8O5.C4H10O3/c2*1-4(2)6(8)11-5-3-10-7(9)12-5;5-1-3-7-4-2-6/h2*5H,1,3H2,2H3;5-6H,1-4H2.
What are the key properties of 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate)?
2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate) has a molecular weight of 450.39 g/mol, XLogP of 0.18, 8 rotatable bonds, 2 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethanol;bis((2-oxo-1,3-dioxolan-4-yl) 2-methylprop-2-enoate) is sourced from PubChem (CID 69164105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).