C14H13ClN2O3 — CID 69164334
1-carbamoyl-6-chloro-2,3,4,9-tetrahydrocarbazole-1-carboxylic acid (PubChem CID 69164334) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is 1-carbamoyl-6-chloro-2,3,4,9-tetrahydrocarbazole-1-carboxylic acid.
| Compound Name | 1-carbamoyl-6-chloro-2,3,4,9-tetrahydrocarbazole-1-carboxylic acid |
|---|---|
| PubChem CID | 69164334 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-carbamoyl-6-chloro-2,3,4,9-tetrahydrocarbazole-1-carboxylic acid |
| SMILES | NC(=O)C1(C(=O)O)CCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C14H13ClN2O3/c15-7-3-4-10-9(6-7)8-2-1-5-14(12(16)18,13(19)20)11(8)17-10/h3-4,6,17H,1-2,5H2,(H2,16,18)(H,19,20) |
| InChIKey | NJCZFCHONONIFA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|