About 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid
4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid (PubChem CID 69164440) has the molecular formula C19H20N4O4S
and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid.
Molecular Properties
| Compound Name | 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid |
| PubChem CID | 69164440 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C12H14N4O2S.C7H6O2/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11;8-7(9)6-4-2-1-3-5-6/h3-7H,13H2,1-2H3,(H,14,15,16);1-5H,(H,8,9) |
| InChIKey | NYVHMSSXFQRODH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid?
The IUPAC name of 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid (CID 69164440) is 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid.
What is the SMILES notation for 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid?
The canonical SMILES for 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid is Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1.O=C(O)c1ccccc1.
What is the InChIKey of 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid?
The InChIKey is NYVHMSSXFQRODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2S.C7H6O2/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11;8-7(9)6-4-2-1-3-5-6/h3-7H,13H2,1-2H3,(H,14,15,16);1-5H,(H,8,9).
What are the key properties of 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid?
4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid has a molecular weight of 400.46 g/mol, XLogP of 2.86, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide;benzoic acid is sourced from PubChem (CID 69164440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).