C23H31N3O3 — CID 69164623
[4-[[2-ethoxy-5-(6-methyl-3-pyridinyl)phenyl]methylamino]cyclohexyl]-methylcarbamic acid (PubChem CID 69164623) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is [4-[[2-ethoxy-5-(6-methyl-3-pyridinyl)phenyl]methylamino]cyclohexyl]-methylcarbamic acid.
| Compound Name | [4-[[2-ethoxy-5-(6-methyl-3-pyridinyl)phenyl]methylamino]cyclohexyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 69164623 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | [4-[[2-ethoxy-5-(6-methyl-3-pyridinyl)phenyl]methylamino]cyclohexyl]-methylcarbamic acid |
| SMILES | CCOc1ccc(-c2ccc(C)nc2)cc1CNC1CCC(N(C)C(=O)O)CC1 |
| InChI | InChI=1S/C23H31N3O3/c1-4-29-22-12-7-17(18-6-5-16(2)24-14-18)13-19(22)15-25-20-8-10-21(11-9-20)26(3)23(27)28/h5-7,12-14,20-21,25H,4,8-11,15H2,1-3H3,(H,27,28) |
| InChIKey | HFTRHHSTCKJNSP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |