About 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one
6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one (PubChem CID 69164717) has the molecular formula C12H14ClNO
and a molecular weight of 223.70 g/mol. Its IUPAC name is 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one |
| PubChem CID | 69164717 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2ccc(CCCCCl)cc21 |
| InChI | InChI=1S/C12H14ClNO/c13-6-2-1-3-9-4-5-10-8-14-12(15)11(10)7-9/h4-5,7H,1-3,6,8H2,(H,14,15) |
| InChIKey | LZNUFBXNDUNZRQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one (CID 69164717) is 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one is O=C1NCc2ccc(CCCCCl)cc21.
What is the InChIKey of 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one?
The InChIKey is LZNUFBXNDUNZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO/c13-6-2-1-3-9-4-5-10-8-14-12(15)11(10)7-9/h4-5,7H,1-3,6,8H2,(H,14,15).
What are the key properties of 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one?
6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one has a molecular weight of 223.70 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorobutyl)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 69164717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).