C20H26FN3O — CID 69165178
4-N-[[5-(6-fluoro-3-pyridinyl)-2-methoxyphenyl]methyl]-1-N-methylcyclohexane-1,4-diamine (PubChem CID 69165178) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-N-[[5-(6-fluoro-3-pyridinyl)-2-methoxyphenyl]methyl]-1-N-methylcyclohexane-1,4-diamine.
| Compound Name | 4-N-[[5-(6-fluoro-3-pyridinyl)-2-methoxyphenyl]methyl]-1-N-methylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 69165178 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-N-[[5-(6-fluoro-3-pyridinyl)-2-methoxyphenyl]methyl]-1-N-methylcyclohexane-1,4-diamine |
| SMILES | CNC1CCC(NCc2cc(-c3ccc(F)nc3)ccc2OC)CC1 |
| InChI | InChI=1S/C20H26FN3O/c1-22-17-5-7-18(8-6-17)23-13-16-11-14(3-9-19(16)25-2)15-4-10-20(21)24-12-15/h3-4,9-12,17-18,22-23H,5-8,13H2,1-2H3 |
| InChIKey | GABMKYQOTCFLAE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|