C29H30N2O — CID 69165231
N-[3-(dimethylamino)-3-(4-methylphenyl)propyl]-4-naphthalen-2-ylbenzamide (PubChem CID 69165231) has the molecular formula C29H30N2O and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[3-(dimethylamino)-3-(4-methylphenyl)propyl]-4-naphthalen-2-ylbenzamide.
| Compound Name | N-[3-(dimethylamino)-3-(4-methylphenyl)propyl]-4-naphthalen-2-ylbenzamide |
|---|---|
| PubChem CID | 69165231 |
| Molecular Formula | C29H30N2O |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N-[3-(dimethylamino)-3-(4-methylphenyl)propyl]-4-naphthalen-2-ylbenzamide |
| SMILES | Cc1ccc(C(CCNC(=O)c2ccc(-c3ccc4ccccc4c3)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C29H30N2O/c1-21-8-10-24(11-9-21)28(31(2)3)18-19-30-29(32)25-15-12-23(13-16-25)27-17-14-22-6-4-5-7-26(22)20-27/h4-17,20,28H,18-19H2,1-3H3,(H,30,32) |
| InChIKey | YGBOZHDVGUDBTP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |