C12H16Br2N2O — CID 69165358
N-[5-bromo-4-(bromomethyl)-2-pyridinyl]-2,2-dimethylbutanamide (PubChem CID 69165358) has the molecular formula C12H16Br2N2O and a molecular weight of 364.08 g/mol. Its IUPAC name is N-[5-bromo-4-(bromomethyl)-2-pyridinyl]-2,2-dimethylbutanamide.
| Compound Name | N-[5-bromo-4-(bromomethyl)-2-pyridinyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 69165358 |
| Molecular Formula | C12H16Br2N2O |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | N-[5-bromo-4-(bromomethyl)-2-pyridinyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cc(CBr)c(Br)cn1 |
| InChI | InChI=1S/C12H16Br2N2O/c1-4-12(2,3)11(17)16-10-5-8(6-13)9(14)7-15-10/h5,7H,4,6H2,1-3H3,(H,15,16,17) |
| InChIKey | BJLXUPUVOUOEEE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|