2-amino-3-(1H-indol-3-yl)propanoic acid

C33H36N6O6 — CID 69165617

IUPAC2-amino-3-(1H-indol-3-yl)propanoic acid
SMILESNC(Cc1c[nH]c2ccccc12)C(=O)O.NC(Cc1c[nH]c2ccccc12)C(=O)O.NC(Cc1c[nH]c2ccccc12)C(=O)O
InChIInChI=1S/3C11H12N2O2/c3*12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h3*1-4,6,9,13H,5,12H2,(H,14,15)
InChIKeyFOOPHOUNKOIKHP-UHFFFAOYSA-N
MW612.69 g/mol
LogP3.37
Rot. Bonds9

About 2-amino-3-(1H-indol-3-yl)propanoic acid

2-amino-3-(1H-indol-3-yl)propanoic acid (PubChem CID 69165617) has the molecular formula C33H36N6O6 and a molecular weight of 612.69 g/mol. Its IUPAC name is 2-amino-3-(1H-indol-3-yl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(1H-indol-3-yl)propanoic acid
PubChem CID69165617
Molecular FormulaC33H36N6O6
Molecular Weight612.69 g/mol
Exact Mass612.27
IUPAC Name2-amino-3-(1H-indol-3-yl)propanoic acid
SMILESNC(Cc1c[nH]c2ccccc12)C(=O)O.NC(Cc1c[nH]c2ccccc12)C(=O)O.NC(Cc1c[nH]c2ccccc12)C(=O)O
InChIInChI=1S/3C11H12N2O2/c3*12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h3*1-4,6,9,13H,5,12H2,(H,14,15)
InChIKeyFOOPHOUNKOIKHP-UHFFFAOYSA-N
XLogP3.37
TPSA237.33 Ų
H-Bond Donors9
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms45
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500612.69
LogP ≤ 53.37
H-Bond Donors ≤ 59
H-Bond Acceptors ≤ 106

Analyze 2-amino-3-(1H-indol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(1H-indol-3-yl)propanoic acid?
The IUPAC name of 2-amino-3-(1H-indol-3-yl)propanoic acid (CID 69165617) is 2-amino-3-(1H-indol-3-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(1H-indol-3-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(1H-indol-3-yl)propanoic acid is NC(Cc1c[nH]c2ccccc12)C(=O)O.NC(Cc1c[nH]c2ccccc12)C(=O)O.NC(Cc1c[nH]c2ccccc12)C(=O)O.
What is the InChIKey of 2-amino-3-(1H-indol-3-yl)propanoic acid?
The InChIKey is FOOPHOUNKOIKHP-UHFFFAOYSA-N. The full InChI is InChI=1S/3C11H12N2O2/c3*12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h3*1-4,6,9,13H,5,12H2,(H,14,15).
What are the key properties of 2-amino-3-(1H-indol-3-yl)propanoic acid?
2-amino-3-(1H-indol-3-yl)propanoic acid has a molecular weight of 612.69 g/mol, XLogP of 3.37, 9 rotatable bonds, 9 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1H-indol-3-yl)propanoic acid is sourced from PubChem (CID 69165617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).