About 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene
6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene (PubChem CID 69166350) has the molecular formula C14H10F4O3S
and a molecular weight of 334.29 g/mol. Its IUPAC name is 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene.
Molecular Properties
| Compound Name | 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene |
| PubChem CID | 69166350 |
| Molecular Formula | C14H10F4O3S |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene |
| SMILES | OS1(O)c2ccc(OC(F)(F)F)cc2Cc2ccc(F)cc21 |
| InChI | InChI=1S/C14H10F4O3S/c15-10-2-1-8-5-9-6-11(21-14(16,17)18)3-4-12(9)22(19,20)13(8)7-10/h1-4,6-7,19-20H,5H2 |
| InChIKey | DLOVYEXNSWAYRA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene?
The IUPAC name of 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene (CID 69166350) is 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene.
What is the SMILES notation for 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene?
The canonical SMILES for 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene is OS1(O)c2ccc(OC(F)(F)F)cc2Cc2ccc(F)cc21.
What is the InChIKey of 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene?
The InChIKey is DLOVYEXNSWAYRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F4O3S/c15-10-2-1-8-5-9-6-11(21-14(16,17)18)3-4-12(9)22(19,20)13(8)7-10/h1-4,6-7,19-20H,5H2.
What are the key properties of 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene?
6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene has a molecular weight of 334.29 g/mol, XLogP of 4.80, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-10,10-dihydroxy-2-(trifluoromethoxy)-9H-thioxanthene is sourced from PubChem (CID 69166350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).