C16H16BrN3O2S — CID 69167138
2-[(5-bromo-4-naphthalen-1-yl-1,2,4-triazol-3-yl)sulfanyl]-2-methylpropane-1,1-diol (PubChem CID 69167138) has the molecular formula C16H16BrN3O2S and a molecular weight of 394.29 g/mol. Its IUPAC name is 2-[(5-bromo-4-naphthalen-1-yl-1,2,4-triazol-3-yl)sulfanyl]-2-methylpropane-1,1-diol.
| Compound Name | 2-[(5-bromo-4-naphthalen-1-yl-1,2,4-triazol-3-yl)sulfanyl]-2-methylpropane-1,1-diol |
|---|---|
| PubChem CID | 69167138 |
| Molecular Formula | C16H16BrN3O2S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2-[(5-bromo-4-naphthalen-1-yl-1,2,4-triazol-3-yl)sulfanyl]-2-methylpropane-1,1-diol |
| SMILES | CC(C)(Sc1nnc(Br)n1-c1cccc2ccccc12)C(O)O |
| InChI | InChI=1S/C16H16BrN3O2S/c1-16(2,13(21)22)23-15-19-18-14(17)20(15)12-9-5-7-10-6-3-4-8-11(10)12/h3-9,13,21-22H,1-2H3 |
| InChIKey | GUAGYTAUEFACET-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|