C21H32NO2+ — CID 69167248
(1,1-dimethylpiperidin-1-ium-4-yl) 1-phenylcycloheptane-1-carboxylate (PubChem CID 69167248) has the molecular formula C21H32NO2+ and a molecular weight of 330.49 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 1-phenylcycloheptane-1-carboxylate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 69167248 |
| Molecular Formula | C21H32NO2+ |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 1-phenylcycloheptane-1-carboxylate |
| SMILES | C[N+]1(C)CCC(OC(=O)C2(c3ccccc3)CCCCCC2)CC1 |
| InChI | InChI=1S/C21H32NO2/c1-22(2)16-12-19(13-17-22)24-20(23)21(14-8-3-4-9-15-21)18-10-6-5-7-11-18/h5-7,10-11,19H,3-4,8-9,12-17H2,1-2H3/q+1 |
| InChIKey | YLLMZSCQYQANKC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|