About 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine
4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine (PubChem CID 69167275) has the molecular formula C15H14Cl2N4O
and a molecular weight of 337.21 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
| PubChem CID | 69167275 |
| Molecular Formula | C15H14Cl2N4O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
| SMILES | CC(C)Oc1cc(-c2nc(N)nc3cc[nH]c23)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N4O/c1-7(2)22-12-5-8(9(16)6-10(12)17)13-14-11(3-4-19-14)20-15(18)21-13/h3-7,19H,1-2H3,(H2,18,20,21) |
| InChIKey | DPCMAZMJAFIWQK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
The IUPAC name of 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine (CID 69167275) is 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine is CC(C)Oc1cc(-c2nc(N)nc3cc[nH]c23)c(Cl)cc1Cl.
What is the InChIKey of 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
The InChIKey is DPCMAZMJAFIWQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2N4O/c1-7(2)22-12-5-8(9(16)6-10(12)17)13-14-11(3-4-19-14)20-15(18)21-13/h3-7,19H,1-2H3,(H2,18,20,21).
What are the key properties of 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine has a molecular weight of 337.21 g/mol, XLogP of 4.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-5H-pyrrolo[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 69167275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).