C18H19Cl2N5O — CID 69167675
4-(2,4-dichloro-5-propan-2-yloxyphenyl)-N,N-dimethyl-5H-pyrrolo[3,2-d]pyrimidine-2-carboximidamide (PubChem CID 69167675) has the molecular formula C18H19Cl2N5O and a molecular weight of 392.29 g/mol. Its IUPAC name is 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-N,N-dimethyl-5H-pyrrolo[3,2-d]pyrimidine-2-carboximidamide.
| Compound Name | 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-N,N-dimethyl-5H-pyrrolo[3,2-d]pyrimidine-2-carboximidamide |
|---|---|
| PubChem CID | 69167675 |
| Molecular Formula | C18H19Cl2N5O |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4-(2,4-dichloro-5-propan-2-yloxyphenyl)-N,N-dimethyl-5H-pyrrolo[3,2-d]pyrimidine-2-carboximidamide |
| SMILES | [H]/N=C(/c1nc(-c2cc(OC(C)C)c(Cl)cc2Cl)c2[nH]ccc2n1)N(C)C |
| InChI | InChI=1S/C18H19Cl2N5O/c1-9(2)26-14-7-10(11(19)8-12(14)20)15-16-13(5-6-22-16)23-18(24-15)17(21)25(3)4/h5-9,21-22H,1-4H3/b21-17- |
| InChIKey | QJROAYUVKGVJPV-FXBPSFAMSA-N |
| XLogP | 4.61 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|