C12H18O4 — CID 69168508
2-[4-(2,2-dimethoxyethoxy)phenyl]ethanol (PubChem CID 69168508) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-[4-(2,2-dimethoxyethoxy)phenyl]ethanol.
| Compound Name | 2-[4-(2,2-dimethoxyethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 69168508 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-[4-(2,2-dimethoxyethoxy)phenyl]ethanol |
| SMILES | COC(COc1ccc(CCO)cc1)OC |
| InChI | InChI=1S/C12H18O4/c1-14-12(15-2)9-16-11-5-3-10(4-6-11)7-8-13/h3-6,12-13H,7-9H2,1-2H3 |
| InChIKey | SDNWASSPJGYUHM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|