C13H19BrO3 — CID 69168520
1-(3-bromopropoxy)-4-(2,2-dimethoxyethyl)benzene (PubChem CID 69168520) has the molecular formula C13H19BrO3 and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-(3-bromopropoxy)-4-(2,2-dimethoxyethyl)benzene.
| Compound Name | 1-(3-bromopropoxy)-4-(2,2-dimethoxyethyl)benzene |
|---|---|
| PubChem CID | 69168520 |
| Molecular Formula | C13H19BrO3 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(3-bromopropoxy)-4-(2,2-dimethoxyethyl)benzene |
| SMILES | COC(Cc1ccc(OCCCBr)cc1)OC |
| InChI | InChI=1S/C13H19BrO3/c1-15-13(16-2)10-11-4-6-12(7-5-11)17-9-3-8-14/h4-7,13H,3,8-10H2,1-2H3 |
| InChIKey | XZMDEUDPDVDHJP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|