About 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol
2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol (PubChem CID 69168553) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol |
| PubChem CID | 69168553 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol |
| SMILES | OCCOCCc1ccc(C2OCCCO2)cc1 |
| InChI | InChI=1S/C14H20O4/c15-7-11-16-10-6-12-2-4-13(5-3-12)14-17-8-1-9-18-14/h2-5,14-15H,1,6-11H2 |
| InChIKey | IZYJOWALDYZXGE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol?
The IUPAC name of 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol (CID 69168553) is 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol?
The canonical SMILES for 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol is OCCOCCc1ccc(C2OCCCO2)cc1.
What is the InChIKey of 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol?
The InChIKey is IZYJOWALDYZXGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c15-7-11-16-10-6-12-2-4-13(5-3-12)14-17-8-1-9-18-14/h2-5,14-15H,1,6-11H2.
What are the key properties of 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol?
2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol has a molecular weight of 252.31 g/mol, XLogP of 1.67, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(1,3-dioxan-2-yl)phenyl]ethoxy]ethanol is sourced from PubChem (CID 69168553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).