C8H10N4O2S — CID 69168640
3-methylsulfanyl-5-(prop-2-enylamino)-1,2,4-triazine-6-carboxylic acid (PubChem CID 69168640) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is 3-methylsulfanyl-5-(prop-2-enylamino)-1,2,4-triazine-6-carboxylic acid.
| Compound Name | 3-methylsulfanyl-5-(prop-2-enylamino)-1,2,4-triazine-6-carboxylic acid |
|---|---|
| PubChem CID | 69168640 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 3-methylsulfanyl-5-(prop-2-enylamino)-1,2,4-triazine-6-carboxylic acid |
| SMILES | C=CCNc1nc(SC)nnc1C(=O)O |
| InChI | InChI=1S/C8H10N4O2S/c1-3-4-9-6-5(7(13)14)11-12-8(10-6)15-2/h3H,1,4H2,2H3,(H,13,14)(H,9,10,12) |
| InChIKey | NTMXQODRVAMMHT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|