C30H33Cl2N7O2 — CID 69168705
(2R)-2-amino-1-[(2S,5R)-2-[2-(3-amino-1H-1,2,4-triazol-5-yl)ethyl]-5-methyl-4-(2-naphthalen-2-ylacetyl)piperazin-1-yl]-3-(2,4-dichlorophenyl)propan-1-one (PubChem CID 69168705) has the molecular formula C30H33Cl2N7O2 and a molecular weight of 594.55 g/mol. Its IUPAC name is (2R)-2-amino-1-[(2S,5R)-2-[2-(3-amino-1H-1,2,4-triazol-5-yl)ethyl]-5-methyl-4-(2-naphthalen-2-ylacetyl)piperazin-1-yl]-3-(2,4-dichlorophenyl)propan-1-one.
| Compound Name | (2R)-2-amino-1-[(2S,5R)-2-[2-(3-amino-1H-1,2,4-triazol-5-yl)ethyl]-5-methyl-4-(2-naphthalen-2-ylacetyl)piperazin-1-yl]-3-(2,4-dichlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 69168705 |
| Molecular Formula | C30H33Cl2N7O2 |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | (2R)-2-amino-1-[(2S,5R)-2-[2-(3-amino-1H-1,2,4-triazol-5-yl)ethyl]-5-methyl-4-(2-naphthalen-2-ylacetyl)piperazin-1-yl]-3-(2,4-dichlorophenyl)propan-1-one |
| SMILES | C[C@@H]1CN(C(=O)[C@H](N)Cc2ccc(Cl)cc2Cl)[C@@H](CCc2nc(N)n[nH]2)CN1C(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H33Cl2N7O2/c1-18-16-39(29(41)26(33)14-22-8-9-23(31)15-25(22)32)24(10-11-27-35-30(34)37-36-27)17-38(18)28(40)13-19-6-7-20-4-2-3-5-21(20)12-19/h2-9,12,15,18,24,26H,10-11,13-14,16-17,33H2,1H3,(H3,34,35,36,37)/t18-,24+,26-/m1/s1 |
| InChIKey | INTTYFSSPGFCCT-VLGQDORFSA-N |
| XLogP | 4.02 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |