About 3,4-dihydro-2H-isoquinoline-1,1-diol
3,4-dihydro-2H-isoquinoline-1,1-diol (PubChem CID 69168957) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3,4-dihydro-2H-isoquinoline-1,1-diol.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-isoquinoline-1,1-diol |
| PubChem CID | 69168957 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3,4-dihydro-2H-isoquinoline-1,1-diol |
| SMILES | OC1(O)NCCc2ccccc21 |
| InChI | InChI=1S/C9H11NO2/c11-9(12)8-4-2-1-3-7(8)5-6-10-9/h1-4,10-12H,5-6H2 |
| InChIKey | OIOHJIMTMVBOHK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-2H-isoquinoline-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-isoquinoline-1,1-diol?
The IUPAC name of 3,4-dihydro-2H-isoquinoline-1,1-diol (CID 69168957) is 3,4-dihydro-2H-isoquinoline-1,1-diol.
What is the SMILES notation for 3,4-dihydro-2H-isoquinoline-1,1-diol?
The canonical SMILES for 3,4-dihydro-2H-isoquinoline-1,1-diol is OC1(O)NCCc2ccccc21.
What is the InChIKey of 3,4-dihydro-2H-isoquinoline-1,1-diol?
The InChIKey is OIOHJIMTMVBOHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c11-9(12)8-4-2-1-3-7(8)5-6-10-9/h1-4,10-12H,5-6H2.
What are the key properties of 3,4-dihydro-2H-isoquinoline-1,1-diol?
3,4-dihydro-2H-isoquinoline-1,1-diol has a molecular weight of 165.19 g/mol, XLogP of -0.07, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-isoquinoline-1,1-diol is sourced from PubChem (CID 69168957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).