About 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine
8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine (PubChem CID 69169199) has the molecular formula C18H14ClN3
and a molecular weight of 307.78 g/mol. Its IUPAC name is 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine.
Molecular Properties
| Compound Name | 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine |
| PubChem CID | 69169199 |
| Molecular Formula | C18H14ClN3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine |
| SMILES | Nc1nc2c(c(-c3ccccc3)n1)-c1ccc(Cl)cc1CC2 |
| InChI | InChI=1S/C18H14ClN3/c19-13-7-8-14-12(10-13)6-9-15-16(14)17(22-18(20)21-15)11-4-2-1-3-5-11/h1-5,7-8,10H,6,9H2,(H2,20,21,22) |
| InChIKey | NZGKMDZQEKHPET-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine?
The IUPAC name of 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine (CID 69169199) is 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine.
What is the SMILES notation for 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine?
The canonical SMILES for 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine is Nc1nc2c(c(-c3ccccc3)n1)-c1ccc(Cl)cc1CC2.
What is the InChIKey of 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine?
The InChIKey is NZGKMDZQEKHPET-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3/c19-13-7-8-14-12(10-13)6-9-15-16(14)17(22-18(20)21-15)11-4-2-1-3-5-11/h1-5,7-8,10H,6,9H2,(H2,20,21,22).
What are the key properties of 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine?
8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine has a molecular weight of 307.78 g/mol, XLogP of 4.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1-phenyl-5,6-dihydrobenzo[f]quinazolin-3-amine is sourced from PubChem (CID 69169199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).