C19H17ClN4O — CID 69169431
8-chloro-1-(3-methoxyphenyl)-5,6-dihydrobenzo[f]quinazoline-3,9-diamine (PubChem CID 69169431) has the molecular formula C19H17ClN4O and a molecular weight of 352.83 g/mol. Its IUPAC name is 8-chloro-1-(3-methoxyphenyl)-5,6-dihydrobenzo[f]quinazoline-3,9-diamine.
| Compound Name | 8-chloro-1-(3-methoxyphenyl)-5,6-dihydrobenzo[f]quinazoline-3,9-diamine |
|---|---|
| PubChem CID | 69169431 |
| Molecular Formula | C19H17ClN4O |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 8-chloro-1-(3-methoxyphenyl)-5,6-dihydrobenzo[f]quinazoline-3,9-diamine |
| SMILES | COc1cccc(-c2nc(N)nc3c2-c2cc(N)c(Cl)cc2CC3)c1 |
| InChI | InChI=1S/C19H17ClN4O/c1-25-12-4-2-3-11(7-12)18-17-13-9-15(21)14(20)8-10(13)5-6-16(17)23-19(22)24-18/h2-4,7-9H,5-6,21H2,1H3,(H2,22,23,24) |
| InChIKey | IYNLATCPYIZSHX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|