About (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide
(2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide (PubChem CID 69170170) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide |
| PubChem CID | 69170170 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCC[C@@]1(C)C(C)C |
| InChI | InChI=1S/C12H24N2O/c1-9(2)12(5)7-6-8-14(12)11(15)13-10(3)4/h9-10H,6-8H2,1-5H3,(H,13,15)/t12-/m0/s1 |
| InChIKey | QPKZTJTZHZDWGZ-LBPRGKRZSA-N |
| XLogP | 2.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide?
The IUPAC name of (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide (CID 69170170) is (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide.
What is the SMILES notation for (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide?
The canonical SMILES for (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide is CC(C)NC(=O)N1CCC[C@@]1(C)C(C)C.
What is the InChIKey of (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide?
The InChIKey is QPKZTJTZHZDWGZ-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H24N2O/c1-9(2)12(5)7-6-8-14(12)11(15)13-10(3)4/h9-10H,6-8H2,1-5H3,(H,13,15)/t12-/m0/s1.
What are the key properties of (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide?
(2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide has a molecular weight of 212.34 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-N,2-di(propan-2-yl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 69170170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).